C13H22F3N3O — CID 63720627
[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 63720627) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]pyrrolidin-1-yl]-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | [2-[(dimethylamino)methyl]pyrrolidin-1-yl]-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 63720627 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [2-[(dimethylamino)methyl]pyrrolidin-1-yl]-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | CN(C)CC1CCCN1C(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C13H22F3N3O/c1-18(2)8-10-4-3-7-19(10)11(20)12(13(14,15)16)5-6-17-9-12/h10,17H,3-9H2,1-2H3 |
| InChIKey | BZUVDBFKHMOJBH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |