C12H10ClN3O5 — CID 63723093
2-chloro-6-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoic acid (PubChem CID 63723093) has the molecular formula C12H10ClN3O5 and a molecular weight of 311.68 g/mol. Its IUPAC name is 2-chloro-6-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-chloro-6-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63723093 |
| Molecular Formula | C12H10ClN3O5 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-chloro-6-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(CN1C(=O)CNC1=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H10ClN3O5/c13-6-2-1-3-7(10(6)11(19)20)15-8(17)5-16-9(18)4-14-12(16)21/h1-3H,4-5H2,(H,14,21)(H,15,17)(H,19,20) |
| InChIKey | KRDHTORWPJZDGF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|