C12H14ClNO5 — CID 63724965
2-chloro-6-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid (PubChem CID 63724965) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-chloro-6-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid.
| Compound Name | 2-chloro-6-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63724965 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-chloro-6-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid |
| SMILES | COCCOCC(=O)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H14ClNO5/c1-18-5-6-19-7-10(15)14-9-4-2-3-8(13)11(9)12(16)17/h2-4H,5-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | IXEOENJVJUWHJN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|