C11H18ClN3 — CID 63728063
6-chloro-N,5-diethyl-N-propan-2-ylpyrimidin-4-amine (PubChem CID 63728063) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 6-chloro-N,5-diethyl-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-N,5-diethyl-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63728063 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-chloro-N,5-diethyl-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CCc1c(Cl)ncnc1N(CC)C(C)C |
| InChI | InChI=1S/C11H18ClN3/c1-5-9-10(12)13-7-14-11(9)15(6-2)8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | KKPVUMXZNBUZBV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |