C13H15Cl2N3S — CID 63729127
6-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-propylpyrimidin-4-amine (PubChem CID 63729127) has the molecular formula C13H15Cl2N3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 6-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63729127 |
| Molecular Formula | C13H15Cl2N3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 6-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H15Cl2N3S/c1-3-4-9-12(15)16-7-17-13(9)18-8(2)10-5-6-11(14)19-10/h5-8H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | YHWFHIRPZQURAL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |