C11H12ClN3S — CID 63729190
6-chloro-5-methyl-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine (PubChem CID 63729190) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 63729190 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 6-chloro-5-methyl-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1NC(C)c1ccsc1 |
| InChI | InChI=1S/C11H12ClN3S/c1-7-10(12)13-6-14-11(7)15-8(2)9-3-4-16-5-9/h3-6,8H,1-2H3,(H,13,14,15) |
| InChIKey | WYHJZHAJFWEXEL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |