C10H9Cl2N3S — CID 79632615
2,5-dichloro-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine (PubChem CID 79632615) has the molecular formula C10H9Cl2N3S and a molecular weight of 274.18 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79632615 |
| Molecular Formula | C10H9Cl2N3S |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2,5-dichloro-N-(1-thiophen-3-ylethyl)pyrimidin-4-amine |
| SMILES | CC(Nc1nc(Cl)ncc1Cl)c1ccsc1 |
| InChI | InChI=1S/C10H9Cl2N3S/c1-6(7-2-3-16-5-7)14-9-8(11)4-13-10(12)15-9/h2-6H,1H3,(H,13,14,15) |
| InChIKey | LHLQHZURVUVSSB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |