C9H9Cl2N5 — CID 106196590
2,5-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 106196590) has the molecular formula C9H9Cl2N5 and a molecular weight of 258.11 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106196590 |
| Molecular Formula | C9H9Cl2N5 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2,5-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | CC(Nc1nc(Cl)ncc1Cl)c1ncc[nH]1 |
| InChI | InChI=1S/C9H9Cl2N5/c1-5(7-12-2-3-13-7)15-8-6(10)4-14-9(11)16-8/h2-5H,1H3,(H,12,13)(H,14,15,16) |
| InChIKey | FATJBVULOYCZTD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |