C11H10Cl2N4O2 — CID 106891698
2,6-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]-4-nitroaniline (PubChem CID 106891698) has the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 106891698 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2,6-dichloro-N-[1-(1H-imidazol-2-yl)ethyl]-4-nitroaniline |
| SMILES | CC(Nc1c(Cl)cc([N+](=O)[O-])cc1Cl)c1ncc[nH]1 |
| InChI | InChI=1S/C11H10Cl2N4O2/c1-6(11-14-2-3-15-11)16-10-8(12)4-7(17(18)19)5-9(10)13/h2-6,16H,1H3,(H,14,15) |
| InChIKey | HAQWXTRFQJHKIR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|