C15H15BrF2N2 — CID 63735129
1-N-[(2-bromophenyl)methyl]-2-(difluoromethyl)-1-N-methylbenzene-1,4-diamine (PubChem CID 63735129) has the molecular formula C15H15BrF2N2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 1-N-[(2-bromophenyl)methyl]-2-(difluoromethyl)-1-N-methylbenzene-1,4-diamine.
| Compound Name | 1-N-[(2-bromophenyl)methyl]-2-(difluoromethyl)-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63735129 |
| Molecular Formula | C15H15BrF2N2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-N-[(2-bromophenyl)methyl]-2-(difluoromethyl)-1-N-methylbenzene-1,4-diamine |
| SMILES | CN(Cc1ccccc1Br)c1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C15H15BrF2N2/c1-20(9-10-4-2-3-5-13(10)16)14-7-6-11(19)8-12(14)15(17)18/h2-8,15H,9,19H2,1H3 |
| InChIKey | YXOGTKKNGYJZAE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|