C12H17F2N3O — CID 63734078
2-[4-amino-2-(difluoromethyl)-N-methylanilino]-N,N-dimethylacetamide (PubChem CID 63734078) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 2-[4-amino-2-(difluoromethyl)-N-methylanilino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-amino-2-(difluoromethyl)-N-methylanilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 63734078 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[4-amino-2-(difluoromethyl)-N-methylanilino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C12H17F2N3O/c1-16(2)11(18)7-17(3)10-5-4-8(15)6-9(10)12(13)14/h4-6,12H,7,15H2,1-3H3 |
| InChIKey | OPTXMGBTUIZFPA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|