C14H15ClN2O — CID 63736051
4-chloro-6-(4-ethylphenoxy)-2,5-dimethylpyrimidine (PubChem CID 63736051) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 4-chloro-6-(4-ethylphenoxy)-2,5-dimethylpyrimidine.
| Compound Name | 4-chloro-6-(4-ethylphenoxy)-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 63736051 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-chloro-6-(4-ethylphenoxy)-2,5-dimethylpyrimidine |
| SMILES | CCc1ccc(Oc2nc(C)nc(Cl)c2C)cc1 |
| InChI | InChI=1S/C14H15ClN2O/c1-4-11-5-7-12(8-6-11)18-14-9(2)13(15)16-10(3)17-14/h5-8H,4H2,1-3H3 |
| InChIKey | JTFUNHNTTFFFRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |