C14H18N4O — CID 63737203
4-(oxan-3-yl)-2-phenylimidazole-1,5-diamine (PubChem CID 63737203) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(oxan-3-yl)-2-phenylimidazole-1,5-diamine.
| Compound Name | 4-(oxan-3-yl)-2-phenylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 63737203 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(oxan-3-yl)-2-phenylimidazole-1,5-diamine |
| SMILES | Nc1c(C2CCCOC2)nc(-c2ccccc2)n1N |
| InChI | InChI=1S/C14H18N4O/c15-13-12(11-7-4-8-19-9-11)17-14(18(13)16)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,15-16H2 |
| InChIKey | XEUFTTNQXLRLSO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |