C18H20N2S — CID 63737220
2-[[1-benzothiophen-3-ylmethyl(ethyl)amino]methyl]aniline (PubChem CID 63737220) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[[1-benzothiophen-3-ylmethyl(ethyl)amino]methyl]aniline.
| Compound Name | 2-[[1-benzothiophen-3-ylmethyl(ethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 63737220 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[[1-benzothiophen-3-ylmethyl(ethyl)amino]methyl]aniline |
| SMILES | CCN(Cc1ccccc1N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C18H20N2S/c1-2-20(11-14-7-3-5-9-17(14)19)12-15-13-21-18-10-6-4-8-16(15)18/h3-10,13H,2,11-12,19H2,1H3 |
| InChIKey | LYPFXXMHKDMUSP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|