C12H15NO6S — CID 63742310
3-[(2-methoxy-2-oxoethyl)-methylsulfamoyl]-2-methylbenzoic acid (PubChem CID 63742310) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-[(2-methoxy-2-oxoethyl)-methylsulfamoyl]-2-methylbenzoic acid.
| Compound Name | 3-[(2-methoxy-2-oxoethyl)-methylsulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 63742310 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3-[(2-methoxy-2-oxoethyl)-methylsulfamoyl]-2-methylbenzoic acid |
| SMILES | COC(=O)CN(C)S(=O)(=O)c1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C12H15NO6S/c1-8-9(12(15)16)5-4-6-10(8)20(17,18)13(2)7-11(14)19-3/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | WFKLIDCXXARBSW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |