C17H16ClNO6S — CID 18615583
2-[(3-chloro-2-methylphenyl)-(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid (PubChem CID 18615583) has the molecular formula C17H16ClNO6S and a molecular weight of 397.84 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylphenyl)-(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid.
| Compound Name | 2-[(3-chloro-2-methylphenyl)-(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 18615583 |
| Molecular Formula | C17H16ClNO6S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-[(3-chloro-2-methylphenyl)-(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid |
| SMILES | COC(=O)CN(c1cccc(Cl)c1C)S(=O)(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H16ClNO6S/c1-11-13(18)7-5-8-14(11)19(10-16(20)25-2)26(23,24)15-9-4-3-6-12(15)17(21)22/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | GRKHWTZFPFHNPA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |