C17H17Cl2NO5S — CID 6374437
methyl 2-[4-[(E)-(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dichlorophenoxy]acetate (PubChem CID 6374437) has the molecular formula C17H17Cl2NO5S and a molecular weight of 418.30 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dichlorophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 6374437 |
| Molecular Formula | C17H17Cl2NO5S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | methyl 2-[4-[(E)-(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-dichlorophenoxy]acetate |
| SMILES | CCC(C)N1C(=O)S/C(=C/c2cc(Cl)c(OCC(=O)OC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H17Cl2NO5S/c1-4-9(2)20-16(22)13(26-17(20)23)7-10-5-11(18)15(12(19)6-10)25-8-14(21)24-3/h5-7,9H,4,8H2,1-3H3/b13-7+ |
| InChIKey | OFDDERINUMZHRY-NTUHNPAUSA-N |
| XLogP | 4.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|