C13H15NO — CID 63749459
(3,4-dimethylphenyl)-(1H-pyrrol-3-yl)methanol (PubChem CID 63749459) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(1H-pyrrol-3-yl)methanol.
| Compound Name | (3,4-dimethylphenyl)-(1H-pyrrol-3-yl)methanol |
|---|---|
| PubChem CID | 63749459 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (3,4-dimethylphenyl)-(1H-pyrrol-3-yl)methanol |
| SMILES | Cc1ccc(C(O)c2cc[nH]c2)cc1C |
| InChI | InChI=1S/C13H15NO/c1-9-3-4-11(7-10(9)2)13(15)12-5-6-14-8-12/h3-8,13-15H,1-2H3 |
| InChIKey | JEUSDPFOSJPRFS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |