C13H23N5O — CID 63750874
1,3-dimethyl-5-[methyl(oxan-3-ylmethyl)amino]pyrazole-4-carboximidamide (PubChem CID 63750874) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-[methyl(oxan-3-ylmethyl)amino]pyrazole-4-carboximidamide.
| Compound Name | 1,3-dimethyl-5-[methyl(oxan-3-ylmethyl)amino]pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63750874 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1,3-dimethyl-5-[methyl(oxan-3-ylmethyl)amino]pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N(C)CC1CCCOC1 |
| InChI | InChI=1S/C13H23N5O/c1-9-11(12(14)15)13(18(3)16-9)17(2)7-10-5-4-6-19-8-10/h10H,4-8H2,1-3H3,(H3,14,15) |
| InChIKey | WECWKLUHPVOWAA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|