C12H12BrClN4O — CID 63750877
5-(2-bromo-4-chlorophenoxy)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 63750877) has the molecular formula C12H12BrClN4O and a molecular weight of 343.61 g/mol. Its IUPAC name is 5-(2-bromo-4-chlorophenoxy)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(2-bromo-4-chlorophenoxy)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63750877 |
| Molecular Formula | C12H12BrClN4O |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 5-(2-bromo-4-chlorophenoxy)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H12BrClN4O/c1-6-10(11(15)16)12(18(2)17-6)19-9-4-3-7(14)5-8(9)13/h3-5H,1-2H3,(H3,15,16) |
| InChIKey | DNTRXJBWOOFQEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|