About ethyl (2R)-2-hydroxypropanoate
ethyl (2R)-2-hydroxypropanoate (PubChem CID 637513) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is ethyl (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-hydroxypropanoate |
| PubChem CID | 637513 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | ethyl (2R)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](C)O |
| InChI | InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | LZCLXQDLBQLTDK-SCSAIBSYSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-hydroxypropanoate?
The IUPAC name of ethyl (2R)-2-hydroxypropanoate (CID 637513) is ethyl (2R)-2-hydroxypropanoate.
What is the SMILES notation for ethyl (2R)-2-hydroxypropanoate?
The canonical SMILES for ethyl (2R)-2-hydroxypropanoate is CCOC(=O)[C@@H](C)O.
What is the InChIKey of ethyl (2R)-2-hydroxypropanoate?
The InChIKey is LZCLXQDLBQLTDK-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of ethyl (2R)-2-hydroxypropanoate?
ethyl (2R)-2-hydroxypropanoate has a molecular weight of 118.13 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-hydroxypropanoate is sourced from PubChem (CID 637513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).