C28H32N4O3S2 — CID 6375557
(5Z)-3-heptyl-5-[[2-[(2-hydroxy-2-phenylethyl)amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6375557) has the molecular formula C28H32N4O3S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is (5Z)-3-heptyl-5-[[2-[(2-hydroxy-2-phenylethyl)amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-heptyl-5-[[2-[(2-hydroxy-2-phenylethyl)amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6375557 |
| Molecular Formula | C28H32N4O3S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (5Z)-3-heptyl-5-[[2-[(2-hydroxy-2-phenylethyl)amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)/C(=C/c2c(NCC(O)c3ccccc3)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C28H32N4O3S2/c1-3-4-5-6-10-15-32-27(35)23(37-28(32)36)17-21-24(29-18-22(33)20-13-8-7-9-14-20)30-25-19(2)12-11-16-31(25)26(21)34/h7-9,11-14,16-17,22,29,33H,3-6,10,15,18H2,1-2H3/b23-17- |
| InChIKey | UEEDDRJCAYRYOA-QJOMJCCJSA-N |
| XLogP | 5.32 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|