C13H22N4O2 — CID 63757545
1,3-dimethyl-5-(2-piperidin-3-ylethoxy)pyrazole-4-carboxamide (PubChem CID 63757545) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2-piperidin-3-ylethoxy)pyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-5-(2-piperidin-3-ylethoxy)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63757545 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1,3-dimethyl-5-(2-piperidin-3-ylethoxy)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(OCCC2CCCNC2)c1C(N)=O |
| InChI | InChI=1S/C13H22N4O2/c1-9-11(12(14)18)13(17(2)16-9)19-7-5-10-4-3-6-15-8-10/h10,15H,3-8H2,1-2H3,(H2,14,18) |
| InChIKey | NGXOYWQQFDBBST-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |