C10H17N3OS — CID 65208510
2-methyl-5-(2-piperidin-3-ylethoxy)-1,3,4-thiadiazole (PubChem CID 65208510) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-methyl-5-(2-piperidin-3-ylethoxy)-1,3,4-thiadiazole.
| Compound Name | 2-methyl-5-(2-piperidin-3-ylethoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 65208510 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-methyl-5-(2-piperidin-3-ylethoxy)-1,3,4-thiadiazole |
| SMILES | Cc1nnc(OCCC2CCCNC2)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-8-12-13-10(15-8)14-6-4-9-3-2-5-11-7-9/h9,11H,2-7H2,1H3 |
| InChIKey | HWLFCAFFWBPSMY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |