C9H15N3OS — CID 65208455
2-methyl-5-(piperidin-3-ylmethoxy)-1,3,4-thiadiazole (PubChem CID 65208455) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-methyl-5-(piperidin-3-ylmethoxy)-1,3,4-thiadiazole.
| Compound Name | 2-methyl-5-(piperidin-3-ylmethoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 65208455 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-methyl-5-(piperidin-3-ylmethoxy)-1,3,4-thiadiazole |
| SMILES | Cc1nnc(OCC2CCCNC2)s1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-11-12-9(14-7)13-6-8-3-2-4-10-5-8/h8,10H,2-6H2,1H3 |
| InChIKey | YSYUQDWTIICXPK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |