C5H9NOS — CID 637592
2,2-dimethyl-1,3-thiazolidin-4-one (PubChem CID 637592) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-thiazolidin-4-one.
| Compound Name | 2,2-dimethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 637592 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 2,2-dimethyl-1,3-thiazolidin-4-one |
| SMILES | CC1(C)NC(=O)CS1 |
| InChI | InChI=1S/C5H9NOS/c1-5(2)6-4(7)3-8-5/h3H2,1-2H3,(H,6,7) |
| InChIKey | RSEKGDNLZPACAU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |