C12H21N3 — CID 63760008
N'-pentan-3-yl-N'-pyridin-4-ylethane-1,2-diamine (PubChem CID 63760008) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-pentan-3-yl-N'-pyridin-4-ylethane-1,2-diamine.
| Compound Name | N'-pentan-3-yl-N'-pyridin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63760008 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-pentan-3-yl-N'-pyridin-4-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(CCN)c1ccncc1 |
| InChI | InChI=1S/C12H21N3/c1-3-11(4-2)15(10-7-13)12-5-8-14-9-6-12/h5-6,8-9,11H,3-4,7,10,13H2,1-2H3 |
| InChIKey | AHLBTUMUABLBMQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |