About 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine
1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine (PubChem CID 63761007) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine |
| PubChem CID | 63761007 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine |
| SMILES | COCC(N)CN(C)c1nc(C)cnc1C |
| InChI | InChI=1S/C11H20N4O/c1-8-5-13-9(2)11(14-8)15(3)6-10(12)7-16-4/h5,10H,6-7,12H2,1-4H3 |
| InChIKey | QUHRJUHRUWNCNI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine?
The IUPAC name of 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine (CID 63761007) is 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine.
What is the SMILES notation for 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine?
The canonical SMILES for 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine is COCC(N)CN(C)c1nc(C)cnc1C.
What is the InChIKey of 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine?
The InChIKey is QUHRJUHRUWNCNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-8-5-13-9(2)11(14-8)15(3)6-10(12)7-16-4/h5,10H,6-7,12H2,1-4H3.
What are the key properties of 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine?
1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine has a molecular weight of 224.31 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3,6-dimethylpyrazin-2-yl)-3-methoxy-1-N-methylpropane-1,2-diamine is sourced from PubChem (CID 63761007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).