C12H21N3O — CID 107203507
5-[(3,6-dimethylpyrazin-2-yl)-methylamino]pentan-1-ol (PubChem CID 107203507) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 5-[(3,6-dimethylpyrazin-2-yl)-methylamino]pentan-1-ol.
| Compound Name | 5-[(3,6-dimethylpyrazin-2-yl)-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107203507 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 5-[(3,6-dimethylpyrazin-2-yl)-methylamino]pentan-1-ol |
| SMILES | Cc1cnc(C)c(N(C)CCCCCO)n1 |
| InChI | InChI=1S/C12H21N3O/c1-10-9-13-11(2)12(14-10)15(3)7-5-4-6-8-16/h9,16H,4-8H2,1-3H3 |
| InChIKey | VQEXVMRVOBPKCC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|