C13H23N3 — CID 63761672
N'-butyl-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine (PubChem CID 63761672) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N'-butyl-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-butyl-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63761672 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N'-butyl-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCCCN(CCN)CCc1ccccn1 |
| InChI | InChI=1S/C13H23N3/c1-2-3-10-16(12-8-14)11-7-13-6-4-5-9-15-13/h4-6,9H,2-3,7-8,10-12,14H2,1H3 |
| InChIKey | STXPZAVQOPZEDW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |