C14H16ClNO2 — CID 63763664
(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(4-hydroxyphenyl)methanone (PubChem CID 63763664) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(4-hydroxyphenyl)methanone.
| Compound Name | (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 63763664 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1C2CCC1CC(Cl)C2 |
| InChI | InChI=1S/C14H16ClNO2/c15-10-7-11-3-4-12(8-10)16(11)14(18)9-1-5-13(17)6-2-9/h1-2,5-6,10-12,17H,3-4,7-8H2 |
| InChIKey | OUJWVMJWTBGIRB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|