C14H19ClN2O2 — CID 119706378
(4-aminophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone;hydrochloride (PubChem CID 119706378) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is (4-aminophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone;hydrochloride.
| Compound Name | (4-aminophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119706378 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (4-aminophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone;hydrochloride |
| SMILES | Cl.Nc1ccc(C(=O)N2C3CCC2CC(O)C3)cc1 |
| InChI | InChI=1S/C14H18N2O2.ClH/c15-10-3-1-9(2-4-10)14(18)16-11-5-6-12(16)8-13(17)7-11;/h1-4,11-13,17H,5-8,15H2;1H |
| InChIKey | XZNDJDIVGCFORC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|