C14H15ClFNO2 — CID 63763941
(4-chloro-2-fluorophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 63763941) has the molecular formula C14H15ClFNO2 and a molecular weight of 283.73 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (4-chloro-2-fluorophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 63763941 |
| Molecular Formula | C14H15ClFNO2 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1F)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C14H15ClFNO2/c15-8-1-4-12(13(16)5-8)14(19)17-9-2-3-10(17)7-11(18)6-9/h1,4-5,9-11,18H,2-3,6-7H2 |
| InChIKey | OMDGOYHVNUYYJX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |