C15H18ClNO2 — CID 115532857
(5-chloro-2-methylphenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 115532857) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is (5-chloro-2-methylphenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (5-chloro-2-methylphenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 115532857 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (5-chloro-2-methylphenyl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | Cc1ccc(Cl)cc1C(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C15H18ClNO2/c1-9-2-3-10(16)6-14(9)15(19)17-11-4-5-12(17)8-13(18)7-11/h2-3,6,11-13,18H,4-5,7-8H2,1H3 |
| InChIKey | ARDBTMOINOHIJU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |