C15H17BrClNO — CID 65309274
(5-bromo-2-methylphenyl)-(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 65309274) has the molecular formula C15H17BrClNO and a molecular weight of 342.66 g/mol. Its IUPAC name is (5-bromo-2-methylphenyl)-(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (5-bromo-2-methylphenyl)-(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 65309274 |
| Molecular Formula | C15H17BrClNO |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (5-bromo-2-methylphenyl)-(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | Cc1ccc(Br)cc1C(=O)N1C2CCC1CC(Cl)C2 |
| InChI | InChI=1S/C15H17BrClNO/c1-9-2-3-10(16)6-14(9)15(19)18-12-4-5-13(18)8-11(17)7-12/h2-3,6,11-13H,4-5,7-8H2,1H3 |
| InChIKey | XWYDPELOSXITNO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|