C12H12N4O2 — CID 63768463
N-(2-aminophenyl)-2-(6-oxopyrimidin-1-yl)acetamide (PubChem CID 63768463) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-(6-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-aminophenyl)-2-(6-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 63768463 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(2-aminophenyl)-2-(6-oxopyrimidin-1-yl)acetamide |
| SMILES | Nc1ccccc1NC(=O)Cn1cnccc1=O |
| InChI | InChI=1S/C12H12N4O2/c13-9-3-1-2-4-10(9)15-11(17)7-16-8-14-6-5-12(16)18/h1-6,8H,7,13H2,(H,15,17) |
| InChIKey | ORGRVSPOPQIRPM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|