C9H11N3OS — CID 63773551
[1-(2-thiophen-2-ylethyl)triazol-4-yl]methanol (PubChem CID 63773551) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is [1-(2-thiophen-2-ylethyl)triazol-4-yl]methanol.
| Compound Name | [1-(2-thiophen-2-ylethyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 63773551 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | [1-(2-thiophen-2-ylethyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(CCc2cccs2)nn1 |
| InChI | InChI=1S/C9H11N3OS/c13-7-8-6-12(11-10-8)4-3-9-2-1-5-14-9/h1-2,5-6,13H,3-4,7H2 |
| InChIKey | NZNFFXJHOQAFFW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |