About 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone
2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 63776491) has the molecular formula C6H8F3NO2S
and a molecular weight of 215.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| PubChem CID | 63776491 |
| Molecular Formula | C6H8F3NO2S |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | O=C(N1CCS(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO2S/c7-6(8,9)5(11)10-1-3-13(12)4-2-10/h1-4H2 |
| InChIKey | LSFFSEGFWYKXGS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The IUPAC name of 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone (CID 63776491) is 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone.
What is the SMILES notation for 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The canonical SMILES for 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone is O=C(N1CCS(=O)CC1)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The InChIKey is LSFFSEGFWYKXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO2S/c7-6(8,9)5(11)10-1-3-13(12)4-2-10/h1-4H2.
What are the key properties of 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone has a molecular weight of 215.20 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-(1-oxo-1,4-thiazinan-4-yl)ethanone is sourced from PubChem (CID 63776491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).