C16H16ClFN2 — CID 63778948
1-[2-(chloromethyl)-4-fluorophenyl]-4-methyl-2,3-dihydroquinoxaline (PubChem CID 63778948) has the molecular formula C16H16ClFN2 and a molecular weight of 290.77 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-fluorophenyl]-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-[2-(chloromethyl)-4-fluorophenyl]-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 63778948 |
| Molecular Formula | C16H16ClFN2 |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-(chloromethyl)-4-fluorophenyl]-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(c2ccc(F)cc2CCl)c2ccccc21 |
| InChI | InChI=1S/C16H16ClFN2/c1-19-8-9-20(16-5-3-2-4-15(16)19)14-7-6-13(18)10-12(14)11-17/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | MDRHQBCXCRGULM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|