C14H13BrN2O4 — CID 63779260
5-bromo-1-[2-(2-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 63779260) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is 5-bromo-1-[2-(2-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[2-(2-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63779260 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-bromo-1-[2-(2-ethoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CCOc1ccccc1C(=O)Cn1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H13BrN2O4/c1-2-21-12-6-4-3-5-9(12)11(18)8-17-7-10(15)13(19)16-14(17)20/h3-7H,2,8H2,1H3,(H,16,19,20) |
| InChIKey | YQZXNVYTVYBJMN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |