C12H21NO5S — CID 63781042
3-[2-(2-methoxyethoxy)acetyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63781042) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)acetyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[2-(2-methoxyethoxy)acetyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63781042 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)acetyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COCCOCC(=O)N1C(C(=O)O)CSC1C(C)C |
| InChI | InChI=1S/C12H21NO5S/c1-8(2)11-13(9(7-19-11)12(15)16)10(14)6-18-5-4-17-3/h8-9,11H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | RNNWRQNWEYCUOM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|