C8H15NO4S2 — CID 63781857
2-ethyl-3-ethylsulfonyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63781857) has the molecular formula C8H15NO4S2 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-ethyl-3-ethylsulfonyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-ethyl-3-ethylsulfonyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63781857 |
| Molecular Formula | C8H15NO4S2 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-ethyl-3-ethylsulfonyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCC1SCC(C(=O)O)N1S(=O)(=O)CC |
| InChI | InChI=1S/C8H15NO4S2/c1-3-7-9(15(12,13)4-2)6(5-14-7)8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | OWNADKWHMGCQKO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |