C9H18N2O5S2 — CID 114814607
2-ethyl-3-(2-methoxyethylsulfamoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 114814607) has the molecular formula C9H18N2O5S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-ethyl-3-(2-methoxyethylsulfamoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-ethyl-3-(2-methoxyethylsulfamoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 114814607 |
| Molecular Formula | C9H18N2O5S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-ethyl-3-(2-methoxyethylsulfamoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCC1SCC(C(=O)O)N1S(=O)(=O)NCCOC |
| InChI | InChI=1S/C9H18N2O5S2/c1-3-8-11(7(6-17-8)9(12)13)18(14,15)10-4-5-16-2/h7-8,10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | UKCQQFLOZSRJPN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|