C8H16N2O6S — CID 104978598
(2S)-4-hydroxy-1-(2-methoxyethylsulfamoyl)pyrrolidine-2-carboxylic acid (PubChem CID 104978598) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(2-methoxyethylsulfamoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-(2-methoxyethylsulfamoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104978598 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2S)-4-hydroxy-1-(2-methoxyethylsulfamoyl)pyrrolidine-2-carboxylic acid |
| SMILES | COCCNS(=O)(=O)N1CC(O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C8H16N2O6S/c1-16-3-2-9-17(14,15)10-5-6(11)4-7(10)8(12)13/h6-7,9,11H,2-5H2,1H3,(H,12,13)/t6?,7-/m0/s1 |
| InChIKey | WKQPRSLGBHTIKM-MLWJPKLSSA-N |
| XLogP | -2.01 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|