C11H20N2O6 — CID 78999454
(2R,4R)-4-hydroxy-1-[2-(2-methoxyethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 78999454) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1-[2-(2-methoxyethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-hydroxy-1-[2-(2-methoxyethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78999454 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2R,4R)-4-hydroxy-1-[2-(2-methoxyethoxy)ethylcarbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COCCOCCNC(=O)N1C[C@H](O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H20N2O6/c1-18-4-5-19-3-2-12-11(17)13-7-8(14)6-9(13)10(15)16/h8-9,14H,2-7H2,1H3,(H,12,17)(H,15,16)/t8-,9-/m1/s1 |
| InChIKey | HQCOZYSVXLPXJE-RKDXNWHRSA-N |
| XLogP | -1.12 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|