C15H22N4OS — CID 63786542
2-[6-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)imidazo[2,1-b][1,3]thiazol-5-yl]ethanamine (PubChem CID 63786542) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-[6-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)imidazo[2,1-b][1,3]thiazol-5-yl]ethanamine.
| Compound Name | 2-[6-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)imidazo[2,1-b][1,3]thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 63786542 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[6-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)imidazo[2,1-b][1,3]thiazol-5-yl]ethanamine |
| SMILES | NCCc1c(N2CCOC3CCCCC32)nc2sccn12 |
| InChI | InChI=1S/C15H22N4OS/c16-6-5-12-14(17-15-19(12)8-10-21-15)18-7-9-20-13-4-2-1-3-11(13)18/h8,10-11,13H,1-7,9,16H2 |
| InChIKey | BIBSIXVKNXONMC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |