C17H24N4 — CID 82753009
2-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)imidazo[1,2-a]pyridin-3-yl]ethanamine (PubChem CID 82753009) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)imidazo[1,2-a]pyridin-3-yl]ethanamine.
| Compound Name | 2-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)imidazo[1,2-a]pyridin-3-yl]ethanamine |
|---|---|
| PubChem CID | 82753009 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)imidazo[1,2-a]pyridin-3-yl]ethanamine |
| SMILES | NCCc1c(N2CCC3CCCCC32)nc2ccccn12 |
| InChI | InChI=1S/C17H24N4/c18-10-8-15-17(19-16-7-3-4-11-20(15)16)21-12-9-13-5-1-2-6-14(13)21/h3-4,7,11,13-14H,1-2,5-6,8-10,12,18H2 |
| InChIKey | AYMNDVFSCKTFTK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |