C11H19NO4 — CID 63788368
4-[2-(3-methylbutoxy)ethyl]morpholine-2,6-dione (PubChem CID 63788368) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[2-(3-methylbutoxy)ethyl]morpholine-2,6-dione.
| Compound Name | 4-[2-(3-methylbutoxy)ethyl]morpholine-2,6-dione |
|---|---|
| PubChem CID | 63788368 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-[2-(3-methylbutoxy)ethyl]morpholine-2,6-dione |
| SMILES | CC(C)CCOCCN1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C11H19NO4/c1-9(2)3-5-15-6-4-12-7-10(13)16-11(14)8-12/h9H,3-8H2,1-2H3 |
| InChIKey | LJDSHKVYTCRDEQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|