C10H8BrF2NO — CID 63788910
3-bromo-1-(3,4-difluorophenyl)pyrrolidin-2-one (PubChem CID 63788910) has the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. Its IUPAC name is 3-bromo-1-(3,4-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 3-bromo-1-(3,4-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 63788910 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 3-bromo-1-(3,4-difluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1C(Br)CCN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8BrF2NO/c11-7-3-4-14(10(7)15)6-1-2-8(12)9(13)5-6/h1-2,5,7H,3-4H2 |
| InChIKey | PXLDPQPLXBFMAG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|