C13H13F2NO3S — CID 63792890
3-(3,5-difluorobenzoyl)-2-ethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63792890) has the molecular formula C13H13F2NO3S and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-(3,5-difluorobenzoyl)-2-ethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(3,5-difluorobenzoyl)-2-ethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63792890 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3-(3,5-difluorobenzoyl)-2-ethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCC1SCC(C(=O)O)N1C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H13F2NO3S/c1-2-11-16(10(6-20-11)13(18)19)12(17)7-3-8(14)5-9(15)4-7/h3-5,10-11H,2,6H2,1H3,(H,18,19) |
| InChIKey | VBHZHYOPIQRNHV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |